C20H28Cl2FN3O — CID 171325652
[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methanone;dihydrochloride (PubChem CID 171325652) has the molecular formula C20H28Cl2FN3O and a molecular weight of 416.37 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325652 |
| Molecular Formula | C20H28Cl2FN3O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(N1C[C@@H]2CNC[C@@H]2[C@@H]1c1cccc(F)c1)C12CCCN1CCC2 |
| InChI | InChI=1S/C20H26FN3O.2ClH/c21-16-5-1-4-14(10-16)18-17-12-22-11-15(17)13-24(18)19(25)20-6-2-8-23(20)9-3-7-20;;/h1,4-5,10,15,17-18,22H,2-3,6-9,11-13H2;2*1H/t15-,17-,18-;;/m0../s1 |
| InChIKey | YDMLEDBXMIFMKM-GWRZQJEISA-N |
| XLogP | 3.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |