C24H36Cl2FN3O — CID 171325950
[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-cyclohexylpiperidin-4-yl)methanone;dihydrochloride (PubChem CID 171325950) has the molecular formula C24H36Cl2FN3O and a molecular weight of 472.48 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-cyclohexylpiperidin-4-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-cyclohexylpiperidin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325950 |
| Molecular Formula | C24H36Cl2FN3O |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-cyclohexylpiperidin-4-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCN(C2CCCCC2)CC1)N1C[C@@H]2CNC[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C24H34FN3O.2ClH/c25-20-6-4-5-18(13-20)23-22-15-26-14-19(22)16-28(23)24(29)17-9-11-27(12-10-17)21-7-2-1-3-8-21;;/h4-6,13,17,19,21-23,26H,1-3,7-12,14-16H2;2*1H/t19-,22-,23+;;/m0../s1 |
| InChIKey | PDSPMJDIHQONAP-KNXCZXMTSA-N |
| XLogP | 4.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |