C20H26FN3O2 — CID 120738005
cyclopropyl-[3-[2-(3-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone (PubChem CID 120738005) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is cyclopropyl-[3-[2-(3-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[3-[2-(3-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120738005 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | cyclopropyl-[3-[2-(3-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCCC(C(=O)N2CCNCC2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H26FN3O2/c21-17-5-1-3-15(11-17)18-12-22-8-10-24(18)20(26)16-4-2-9-23(13-16)19(25)14-6-7-14/h1,3,5,11,14,16,18,22H,2,4,6-10,12-13H2 |
| InChIKey | VNIMTWVOFHGGGR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |