C22H25FN4O2 — CID 120737862
[2-(3-fluorophenyl)piperazin-1-yl]-[1-(pyridine-4-carbonyl)piperidin-3-yl]methanone (PubChem CID 120737862) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-[1-(pyridine-4-carbonyl)piperidin-3-yl]methanone.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-[1-(pyridine-4-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 120737862 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-[1-(pyridine-4-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCCC(C(=O)N2CCNCC2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C22H25FN4O2/c23-19-5-1-3-17(13-19)20-14-25-10-12-27(20)22(29)18-4-2-11-26(15-18)21(28)16-6-8-24-9-7-16/h1,3,5-9,13,18,20,25H,2,4,10-12,14-15H2 |
| InChIKey | SVLHVALFIDGDHY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |