C15H20ClFN2O2 — CID 120735794
[2-(3-fluorophenyl)piperazin-1-yl]-(oxolan-3-yl)methanone;hydrochloride (PubChem CID 120735794) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-(oxolan-3-yl)methanone;hydrochloride.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-(oxolan-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120735794 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-(oxolan-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCOC1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN2O2.ClH/c16-13-3-1-2-11(8-13)14-9-17-5-6-18(14)15(19)12-4-7-20-10-12;/h1-3,8,12,14,17H,4-7,9-10H2;1H |
| InChIKey | JLKYKUDIDCXIFF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |