C16H22ClFN2OS — CID 120737909
[2-(3-fluorophenyl)piperazin-1-yl]-(thian-4-yl)methanone;hydrochloride (PubChem CID 120737909) has the molecular formula C16H22ClFN2OS and a molecular weight of 344.88 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-(thian-4-yl)methanone;hydrochloride.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-(thian-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120737909 |
| Molecular Formula | C16H22ClFN2OS |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-(thian-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCSCC1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2OS.ClH/c17-14-3-1-2-13(10-14)15-11-18-6-7-19(15)16(20)12-4-8-21-9-5-12;/h1-3,10,12,15,18H,4-9,11H2;1H |
| InChIKey | XHRBUGPIXURFQQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |