C18H26N2OS — CID 120741561
[2-(4-ethylphenyl)piperazin-1-yl]-(thian-4-yl)methanone (PubChem CID 120741561) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is [2-(4-ethylphenyl)piperazin-1-yl]-(thian-4-yl)methanone.
| Compound Name | [2-(4-ethylphenyl)piperazin-1-yl]-(thian-4-yl)methanone |
|---|---|
| PubChem CID | 120741561 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [2-(4-ethylphenyl)piperazin-1-yl]-(thian-4-yl)methanone |
| SMILES | CCc1ccc(C2CNCCN2C(=O)C2CCSCC2)cc1 |
| InChI | InChI=1S/C18H26N2OS/c1-2-14-3-5-15(6-4-14)17-13-19-9-10-20(17)18(21)16-7-11-22-12-8-16/h3-6,16-17,19H,2,7-13H2,1H3 |
| InChIKey | KTKIWECPRVWKFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |