C15H16ClFN2OS — CID 120736351
[2-(3-fluorophenyl)piperazin-1-yl]-thiophen-3-ylmethanone;hydrochloride (PubChem CID 120736351) has the molecular formula C15H16ClFN2OS and a molecular weight of 326.82 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-thiophen-3-ylmethanone;hydrochloride.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-thiophen-3-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120736351 |
| Molecular Formula | C15H16ClFN2OS |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-thiophen-3-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccsc1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H15FN2OS.ClH/c16-13-3-1-2-11(8-13)14-9-17-5-6-18(14)15(19)12-4-7-20-10-12;/h1-4,7-8,10,14,17H,5-6,9H2;1H |
| InChIKey | CRLAJTSJBXEJSR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |