C18H19FN2OS — CID 120737064
[2-(3-fluorophenyl)piperazin-1-yl]-(4-methylsulfanylphenyl)methanone (PubChem CID 120737064) has the molecular formula C18H19FN2OS and a molecular weight of 330.43 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylsulfanylphenyl)methanone.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 120737064 |
| Molecular Formula | C18H19FN2OS |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(C(=O)N2CCNCC2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H19FN2OS/c1-23-16-7-5-13(6-8-16)18(22)21-10-9-20-12-17(21)14-3-2-4-15(19)11-14/h2-8,11,17,20H,9-10,12H2,1H3 |
| InChIKey | QVLYFQORIJEWTR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |