C20H21FN2O — CID 120737068
2,3-dihydro-1H-inden-5-yl-[2-(3-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 120737068) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-[2-(3-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120737068 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)CCC2)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C20H21FN2O/c21-18-6-2-5-16(12-18)19-13-22-9-10-23(19)20(24)17-8-7-14-3-1-4-15(14)11-17/h2,5-8,11-12,19,22H,1,3-4,9-10,13H2 |
| InChIKey | NTYZCELDUBHJGR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |