C18H20ClFN2O — CID 120737441
[2-(3-fluorophenyl)piperazin-1-yl]-(4-methylphenyl)methanone;hydrochloride (PubChem CID 120737441) has the molecular formula C18H20ClFN2O and a molecular weight of 334.82 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylphenyl)methanone;hydrochloride.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120737441 |
| Molecular Formula | C18H20ClFN2O |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-(4-methylphenyl)methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCNCC2c2cccc(F)c2)cc1.Cl |
| InChI | InChI=1S/C18H19FN2O.ClH/c1-13-5-7-14(8-6-13)18(22)21-10-9-20-12-17(21)15-3-2-4-16(19)11-15;/h2-8,11,17,20H,9-10,12H2,1H3;1H |
| InChIKey | JSHPZUSCLFLBDW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |