C20H19ClFN3O3 — CID 120738086
5-[2-(3-fluorophenyl)piperazine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride (PubChem CID 120738086) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)piperazine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-[2-(3-fluorophenyl)piperazine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 120738086 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-[2-(3-fluorophenyl)piperazine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride |
| SMILES | CN1C(=O)c2ccc(C(=O)N3CCNCC3c3cccc(F)c3)cc2C1=O.Cl |
| InChI | InChI=1S/C20H18FN3O3.ClH/c1-23-19(26)15-6-5-13(10-16(15)20(23)27)18(25)24-8-7-22-11-17(24)12-3-2-4-14(21)9-12;/h2-6,9-10,17,22H,7-8,11H2,1H3;1H |
| InChIKey | OCSYAUOCVOBQNY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|