C15H15BrClFN2OS — CID 120737625
(5-bromothiophen-3-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120737625) has the molecular formula C15H15BrClFN2OS and a molecular weight of 405.72 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (5-bromothiophen-3-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120737625 |
| Molecular Formula | C15H15BrClFN2OS |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | (5-bromothiophen-3-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1csc(Br)c1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H14BrFN2OS.ClH/c16-14-7-11(9-21-14)15(20)19-5-4-18-8-13(19)10-2-1-3-12(17)6-10;/h1-3,6-7,9,13,18H,4-5,8H2;1H |
| InChIKey | LMQACEQCXXKBCE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |