C16H18ClFN2OS — CID 120736765
[2-(3-fluorophenyl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone;hydrochloride (PubChem CID 120736765) has the molecular formula C16H18ClFN2OS and a molecular weight of 340.85 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone;hydrochloride.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120736765 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone;hydrochloride |
| SMILES | Cc1ccsc1C(=O)N1CCNCC1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C16H17FN2OS.ClH/c1-11-5-8-21-15(11)16(20)19-7-6-18-10-14(19)12-3-2-4-13(17)9-12;/h2-5,8-9,14,18H,6-7,10H2,1H3;1H |
| InChIKey | WDXCAASZLBIWAU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |