C17H20ClFN2OS — CID 120736289
(3-ethylthiophen-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120736289) has the molecular formula C17H20ClFN2OS and a molecular weight of 354.88 g/mol. Its IUPAC name is (3-ethylthiophen-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (3-ethylthiophen-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120736289 |
| Molecular Formula | C17H20ClFN2OS |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (3-ethylthiophen-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | CCc1ccsc1C(=O)N1CCNCC1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C17H19FN2OS.ClH/c1-2-12-6-9-22-16(12)17(21)20-8-7-19-11-15(20)13-4-3-5-14(18)10-13;/h3-6,9-10,15,19H,2,7-8,11H2,1H3;1H |
| InChIKey | GCDABNLSWLABSO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |