C18H21FN2O2 — CID 120735525
(5-ethyl-4-methylfuran-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 120735525) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is (5-ethyl-4-methylfuran-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (5-ethyl-4-methylfuran-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120735525 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (5-ethyl-4-methylfuran-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | CCc1oc(C(=O)N2CCNCC2c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C18H21FN2O2/c1-3-16-12(2)9-17(23-16)18(22)21-8-7-20-11-15(21)13-5-4-6-14(19)10-13/h4-6,9-10,15,20H,3,7-8,11H2,1-2H3 |
| InChIKey | QOHPMADMMAWSGG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |