C17H18ClFN4O2 — CID 171711993
3-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyridazin-6-one;hydrochloride (PubChem CID 171711993) has the molecular formula C17H18ClFN4O2 and a molecular weight of 364.81 g/mol. Its IUPAC name is 3-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyridazin-6-one;hydrochloride.
| Compound Name | 3-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyridazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 171711993 |
| Molecular Formula | C17H18ClFN4O2 |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyridazin-6-one;hydrochloride |
| SMILES | Cl.O=C(c1ccc(=O)[nH]n1)N1C[C@@H]2CNC[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN4O2.ClH/c18-12-3-1-2-10(6-12)16-13-8-19-7-11(13)9-22(16)17(24)14-4-5-15(23)21-20-14;/h1-6,11,13,16,19H,7-9H2,(H,21,23);1H/t11-,13-,16+;/m0./s1 |
| InChIKey | ODRPGTQHJXMMME-ONSHJTMMSA-N |
| XLogP | 1.36 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |