C20H24ClFN4O2 — CID 171706846
5-[2-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 171706846) has the molecular formula C20H24ClFN4O2 and a molecular weight of 406.89 g/mol. Its IUPAC name is 5-[2-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 5-[2-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 171706846 |
| Molecular Formula | C20H24ClFN4O2 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-[2-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | Cc1nc(C)c(CC(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2cccc(F)c2)c(=O)[nH]1.Cl |
| InChI | InChI=1S/C20H23FN4O2.ClH/c1-11-16(20(27)24-12(2)23-11)7-18(26)25-10-14-8-22-9-17(14)19(25)13-4-3-5-15(21)6-13;/h3-6,14,17,19,22H,7-10H2,1-2H3,(H,23,24,27);1H/t14-,17-,19-;/m0./s1 |
| InChIKey | XUTWKLKVLDIWSY-BPAHDCPGSA-N |
| XLogP | 1.91 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |