C21H19ClF4N4O — CID 171707977
[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone;hydrochloride (PubChem CID 171707977) has the molecular formula C21H19ClF4N4O and a molecular weight of 454.86 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171707977 |
| Molecular Formula | C21H19ClF4N4O |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc2nc(C(F)(F)F)[nH]c2c1)N1C[C@@H]2CNC[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C21H18F4N4O.ClH/c22-14-3-1-2-11(6-14)18-15-9-26-8-13(15)10-29(18)19(30)12-4-5-16-17(7-12)28-20(27-16)21(23,24)25;/h1-7,13,15,18,26H,8-10H2,(H,27,28);1H/t13-,15-,18+;/m0./s1 |
| InChIKey | HCWKUGZSNPIEEM-BXLUGPMJSA-N |
| XLogP | 4.18 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |