C17H22ClN5O — CID 171707634
1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1,2,4-triazol-1-yl)propan-1-one;hydrochloride (PubChem CID 171707634) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1,2,4-triazol-1-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1,2,4-triazol-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171707634 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1,2,4-triazol-1-yl)propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCn1cncn1)N1C[C@@H]2CNC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21N5O.ClH/c23-16(6-7-21-12-19-11-20-21)22-10-14-8-18-9-15(14)17(22)13-4-2-1-3-5-13;/h1-5,11-12,14-15,17-18H,6-10H2;1H/t14-,15-,17+;/m0./s1 |
| InChIKey | AEDCDVCWRSAVOR-NOYXXFKXSA-N |
| XLogP | 1.51 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |