C23H30Cl2FN3O2 — CID 171325886
[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride (PubChem CID 171325886) has the molecular formula C23H30Cl2FN3O2 and a molecular weight of 470.42 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride.
| Compound Name | [(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325886 |
| Molecular Formula | C23H30Cl2FN3O2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(C(=O)c4cc(CCN)ccc4F)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H28FN3O2.2ClH/c1-26-12-17-13-27(23(28)19-11-15(9-10-25)3-8-21(19)24)14-20(17)22(26)16-4-6-18(29-2)7-5-16;;/h3-8,11,17,20,22H,9-10,12-14,25H2,1-2H3;2*1H/t17-,20+,22+;;/m0../s1 |
| InChIKey | PSUFROZWODYWHO-XAHLENMOSA-N |
| XLogP | 3.55 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |