C19H23ClN4O4 — CID 171707631
5-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 171707631) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is 5-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 5-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171707631 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(C(=O)c4c[nH]c(=O)[nH]c4=O)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C19H22N4O4.ClH/c1-22-8-12-9-23(18(25)14-7-20-19(26)21-17(14)24)10-15(12)16(22)11-3-5-13(27-2)6-4-11;/h3-7,12,15-16H,8-10H2,1-2H3,(H2,20,21,24,26);1H/t12-,15+,16+;/m0./s1 |
| InChIKey | JZGZUILJJNPVGZ-VEVZXVCZSA-N |
| XLogP | 0.87 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |