C22H32Cl2N4O2 — CID 171325236
1-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(2-ethylimidazol-1-yl)propan-1-one;dihydrochloride (PubChem CID 171325236) has the molecular formula C22H32Cl2N4O2 and a molecular weight of 455.43 g/mol. Its IUPAC name is 1-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(2-ethylimidazol-1-yl)propan-1-one;dihydrochloride.
| Compound Name | 1-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(2-ethylimidazol-1-yl)propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 171325236 |
| Molecular Formula | C22H32Cl2N4O2 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(2-ethylimidazol-1-yl)propan-1-one;dihydrochloride |
| SMILES | CCc1nccn1CCC(=O)N1C[C@@H]2CN(C)[C@@H](c3ccc(OC)cc3)[C@@H]2C1.Cl.Cl |
| InChI | InChI=1S/C22H30N4O2.2ClH/c1-4-20-23-10-12-25(20)11-9-21(27)26-14-17-13-24(2)22(19(17)15-26)16-5-7-18(28-3)8-6-16;;/h5-8,10,12,17,19,22H,4,9,11,13-15H2,1-3H3;2*1H/t17-,19+,22-;;/m0../s1 |
| InChIKey | FUZFQLDIKPJFDC-JIUNIAPSSA-N |
| XLogP | 3.45 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |