C21H31ClN2O3 — CID 171709530
[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride (PubChem CID 171709530) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171709530 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(C(=O)C4(O)CCCCC4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C21H30N2O3.ClH/c1-22-12-16-13-23(20(24)21(25)10-4-3-5-11-21)14-18(16)19(22)15-6-8-17(26-2)9-7-15;/h6-9,16,18-19,25H,3-5,10-14H2,1-2H3;1H/t16-,18+,19-;/m0./s1 |
| InChIKey | YKHPGLUODMVDLY-DDBXZWFTSA-N |
| XLogP | 2.87 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |