C21H27ClN4O3 — CID 171709389
3-[3-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxopropyl]-1H-pyridazin-6-one;hydrochloride (PubChem CID 171709389) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is 3-[3-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxopropyl]-1H-pyridazin-6-one;hydrochloride.
| Compound Name | 3-[3-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxopropyl]-1H-pyridazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 171709389 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[3-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxopropyl]-1H-pyridazin-6-one;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(C(=O)CCc4ccc(=O)[nH]n4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C21H26N4O3.ClH/c1-24-11-15-12-25(20(27)10-6-16-5-9-19(26)23-22-16)13-18(15)21(24)14-3-7-17(28-2)8-4-14;/h3-5,7-9,15,18,21H,6,10-13H2,1-2H3,(H,23,26);1H/t15-,18+,21+;/m0./s1 |
| InChIKey | VWXNVHHIAFUKOD-NKFZUDRTSA-N |
| XLogP | 1.89 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |