C20H31ClN2O3S — CID 171708579
(3R,3aS,6aS)-5-(cyclopentylmethylsulfonyl)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171708579) has the molecular formula C20H31ClN2O3S and a molecular weight of 415.00 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(cyclopentylmethylsulfonyl)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3R,3aS,6aS)-5-(cyclopentylmethylsulfonyl)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171708579 |
| Molecular Formula | C20H31ClN2O3S |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (3R,3aS,6aS)-5-(cyclopentylmethylsulfonyl)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(S(=O)(=O)CC4CCCC4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C20H30N2O3S.ClH/c1-21-11-17-12-22(26(23,24)14-15-5-3-4-6-15)13-19(17)20(21)16-7-9-18(25-2)10-8-16;/h7-10,15,17,19-20H,3-6,11-14H2,1-2H3;1H/t17-,19+,20-;/m0./s1 |
| InChIKey | VOQMIMXYWURKAE-HYGWFALKSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |