C24H35Cl2N5O — CID 171329615
(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171329615) has the molecular formula C24H35Cl2N5O and a molecular weight of 480.48 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171329615 |
| Molecular Formula | C24H35Cl2N5O |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(Cc4cnc(N5CCCCC5)nc4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C24H33N5O.2ClH/c1-27-15-20-16-28(17-22(20)23(27)19-6-8-21(30-2)9-7-19)14-18-12-25-24(26-13-18)29-10-4-3-5-11-29;;/h6-9,12-13,20,22-23H,3-5,10-11,14-17H2,1-2H3;2*1H/t20-,22+,23+;;/m0../s1 |
| InChIKey | JORKYBDXZKFGLP-AUBZFFHBSA-N |
| XLogP | 4.05 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |