C21H25ClF3N3O — CID 171708057
(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171708057) has the molecular formula C21H25ClF3N3O and a molecular weight of 427.90 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171708057 |
| Molecular Formula | C21H25ClF3N3O |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(Cc4ccc(C(F)(F)F)nc4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C21H24F3N3O.ClH/c1-26-11-16-12-27(10-14-3-8-19(25-9-14)21(22,23)24)13-18(16)20(26)15-4-6-17(28-2)7-5-15;/h3-9,16,18,20H,10-13H2,1-2H3;1H/t16-,18+,20+;/m0./s1 |
| InChIKey | GOUVEOGJDBQCTD-DNHMSYDNSA-N |
| XLogP | 4.27 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |