C23H26F3N3O3 — CID 172897123
1-[(3aR,4S,6aS)-4-phenyl-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one;formic acid (PubChem CID 172897123) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-phenyl-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one;formic acid.
| Compound Name | 1-[(3aR,4S,6aS)-4-phenyl-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one;formic acid |
|---|---|
| PubChem CID | 172897123 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-phenyl-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one;formic acid |
| SMILES | CCC(=O)N1C[C@@H]2CN(Cc3ccc(C(F)(F)F)nc3)C[C@@H]2[C@H]1c1ccccc1.O=CO |
| InChI | InChI=1S/C22H24F3N3O.CH2O2/c1-2-20(29)28-13-17-12-27(11-15-8-9-19(26-10-15)22(23,24)25)14-18(17)21(28)16-6-4-3-5-7-16;2-1-3/h3-10,17-18,21H,2,11-14H2,1H3;1H,(H,2,3)/t17-,18-,21+;/m0./s1 |
| InChIKey | ZOGHGCCXGXSNNI-ZTLGLYPESA-N |
| XLogP | 3.84 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|