C22H28N4O2 — CID 171911549
[(3aR,4S,6aS)-2-(5-methyl-1,3,4-oxadiazol-2-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclohexylmethanone (PubChem CID 171911549) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2-(5-methyl-1,3,4-oxadiazol-2-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclohexylmethanone.
| Compound Name | [(3aR,4S,6aS)-2-(5-methyl-1,3,4-oxadiazol-2-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 171911549 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(3aR,4S,6aS)-2-(5-methyl-1,3,4-oxadiazol-2-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclohexylmethanone |
| SMILES | Cc1nnc(N2C[C@H]3CN(C(=O)C4CCCCC4)[C@H](c4ccccc4)[C@H]3C2)o1 |
| InChI | InChI=1S/C22H28N4O2/c1-15-23-24-22(28-15)25-12-18-13-26(21(27)17-10-6-3-7-11-17)20(19(18)14-25)16-8-4-2-5-9-16/h2,4-5,8-9,17-20H,3,6-7,10-14H2,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | AASDJOGZGLEJTG-SLFFLAALSA-N |
| XLogP | 3.59 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |