C23H26N4O2 — CID 170504412
[(3aR,4S,6aS)-4-phenyl-2-(pyrazine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone (PubChem CID 170504412) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2-(pyrazine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2-(pyrazine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 170504412 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2-(pyrazine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@H]2CN(C(=O)C3CCCC3)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(17-8-4-5-9-17)27-14-18-13-26(23(29)20-12-24-10-11-25-20)15-19(18)21(27)16-6-2-1-3-7-16/h1-3,6-7,10-12,17-19,21H,4-5,8-9,13-15H2/t18-,19-,21+/m0/s1 |
| InChIKey | OTCCKCWZDAEBOQ-IRFCIJBXSA-N |
| XLogP | 2.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |