C22H26N4O2S — CID 171386284
[(3aR,4S,6aS)-2-(2-amino-1,3-thiazole-4-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone (PubChem CID 171386284) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2-(2-amino-1,3-thiazole-4-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,4S,6aS)-2-(2-amino-1,3-thiazole-4-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 171386284 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [(3aR,4S,6aS)-2-(2-amino-1,3-thiazole-4-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C(=O)c3csc(N)n3)C[C@H]2CN1C(=O)C1CCC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-13-5-2-3-8-16(13)19-17-11-25(21(28)18-12-29-22(23)24-18)9-15(17)10-26(19)20(27)14-6-4-7-14/h2-3,5,8,12,14-15,17,19H,4,6-7,9-11H2,1H3,(H2,23,24)/t15-,17-,19+/m0/s1 |
| InChIKey | MFWPIYLCQRMWJG-VDZJLULYSA-N |
| XLogP | 3.11 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |