C22H23N5O2 — CID 171389257
[(3aR,4S,6aS)-4-(2-methylphenyl)-2-(1H-pyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 171389257) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(1H-pyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(1H-pyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 171389257 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(1H-pyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C(=O)c3cn[nH]c3)C[C@H]2CN1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-5-2-3-6-17(14)20-18-13-26(21(28)15-9-24-25-10-15)11-16(18)12-27(20)22(29)19-7-4-8-23-19/h2-10,16,18,20,23H,11-13H2,1H3,(H,24,25)/t16-,18-,20+/m0/s1 |
| InChIKey | OWPZPQHADUWQGQ-XKGZKEIXSA-N |
| XLogP | 2.63 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |