C20H24N4O2 — CID 171909377
2-[(3aR,4S,6aS)-4-(2-methylphenyl)-5-(1H-pyrrole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide (PubChem CID 171909377) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[(3aR,4S,6aS)-4-(2-methylphenyl)-5-(1H-pyrrole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide.
| Compound Name | 2-[(3aR,4S,6aS)-4-(2-methylphenyl)-5-(1H-pyrrole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide |
|---|---|
| PubChem CID | 171909377 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[(3aR,4S,6aS)-4-(2-methylphenyl)-5-(1H-pyrrole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetamide |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(CC(N)=O)C[C@H]2CN1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-5-2-3-6-15(13)19-16-11-23(12-18(21)25)9-14(16)10-24(19)20(26)17-7-4-8-22-17/h2-8,14,16,19,22H,9-12H2,1H3,(H2,21,25)/t14-,16-,19+/m0/s1 |
| InChIKey | UAIRPWKLTFJVAX-URLQWDBASA-N |
| XLogP | 1.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |