C23H30N2O2S — CID 171914464
[(3aR,4R,6aS)-4-(2-methylphenyl)-2-(2-propan-2-ylsulfanylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone (PubChem CID 171914464) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(2-methylphenyl)-2-(2-propan-2-ylsulfanylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-(2-methylphenyl)-2-(2-propan-2-ylsulfanylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 171914464 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [(3aR,4R,6aS)-4-(2-methylphenyl)-2-(2-propan-2-ylsulfanylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone |
| SMILES | Cc1ccccc1[C@H]1[C@H]2CN(CCSC(C)C)C[C@H]2CN1C(=O)c1ccco1 |
| InChI | InChI=1S/C23H30N2O2S/c1-16(2)28-12-10-24-13-18-14-25(23(26)21-9-6-11-27-21)22(20(18)15-24)19-8-5-4-7-17(19)3/h4-9,11,16,18,20,22H,10,12-15H2,1-3H3/t18-,20-,22-/m0/s1 |
| InChIKey | WEMYFEUXJXYTSZ-VCOUNFBDSA-N |
| XLogP | 4.47 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |