C22H22N4O2 — CID 171911265
[(3aR,4S,6aS)-4-(2-methylphenyl)-2-pyrimidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone (PubChem CID 171911265) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2-pyrimidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-pyrimidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 171911265 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-pyrimidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-2-yl)methanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(c3ccncn3)C[C@H]2CN1C(=O)c1ccco1 |
| InChI | InChI=1S/C22H22N4O2/c1-15-5-2-3-6-17(15)21-18-13-25(20-8-9-23-14-24-20)11-16(18)12-26(21)22(27)19-7-4-10-28-19/h2-10,14,16,18,21H,11-13H2,1H3/t16-,18-,21+/m0/s1 |
| InChIKey | XROXRQRWFDEACE-DJPFJPOOSA-N |
| XLogP | 3.33 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |