C26H33N3O — CID 170509065
1-[(3aR,4S,6aS)-2-cyclopentyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-3-ylpropan-1-one (PubChem CID 170509065) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-2-cyclopentyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[(3aR,4S,6aS)-2-cyclopentyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 170509065 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[(3aR,4S,6aS)-2-cyclopentyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-3-ylpropan-1-one |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C3CCCC3)C[C@H]2CN1C(=O)CCc1cccnc1 |
| InChI | InChI=1S/C26H33N3O/c1-19-7-2-5-11-23(19)26-24-18-28(22-9-3-4-10-22)16-21(24)17-29(26)25(30)13-12-20-8-6-14-27-15-20/h2,5-8,11,14-15,21-22,24,26H,3-4,9-10,12-13,16-18H2,1H3/t21-,24-,26+/m0/s1 |
| InChIKey | QVCHUURZDFFVJW-PMWMKWCKSA-N |
| XLogP | 4.40 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |