C24H27N3O3 — CID 171910594
[(3aR,4S,6aS)-4-(2-methylphenyl)-5-(pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(3-hydroxycyclobutyl)methanone (PubChem CID 171910594) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-5-(pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(3-hydroxycyclobutyl)methanone.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-5-(pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(3-hydroxycyclobutyl)methanone |
|---|---|
| PubChem CID | 171910594 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-5-(pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(3-hydroxycyclobutyl)methanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C(=O)C3CC(O)C3)C[C@H]2CN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C24H27N3O3/c1-15-5-2-3-7-20(15)22-21-14-26(23(29)17-9-19(28)10-17)12-18(21)13-27(22)24(30)16-6-4-8-25-11-16/h2-8,11,17-19,21-22,28H,9-10,12-14H2,1H3/t17?,18-,19?,21-,22+/m0/s1 |
| InChIKey | ZUIBTDCESCQYQB-MNCQZSHMSA-N |
| XLogP | 2.43 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |