C23H36Cl2N4O2 — CID 171325447
1-[(3aS,4R,6aR)-4-(2-methylphenyl)-2-(piperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(dimethylamino)ethanone;dihydrochloride (PubChem CID 171325447) has the molecular formula C23H36Cl2N4O2 and a molecular weight of 471.47 g/mol. Its IUPAC name is 1-[(3aS,4R,6aR)-4-(2-methylphenyl)-2-(piperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(dimethylamino)ethanone;dihydrochloride.
| Compound Name | 1-[(3aS,4R,6aR)-4-(2-methylphenyl)-2-(piperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(dimethylamino)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171325447 |
| Molecular Formula | C23H36Cl2N4O2 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[(3aS,4R,6aR)-4-(2-methylphenyl)-2-(piperidine-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(dimethylamino)ethanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)C3CCNCC3)C[C@@H]2CN1C(=O)CN(C)C.Cl.Cl |
| InChI | InChI=1S/C23H34N4O2.2ClH/c1-16-6-4-5-7-19(16)22-20-14-26(23(29)17-8-10-24-11-9-17)12-18(20)13-27(22)21(28)15-25(2)3;;/h4-7,17-18,20,22,24H,8-15H2,1-3H3;2*1H/t18-,20-,22+;;/m1../s1 |
| InChIKey | INYVMRJCJXJRDI-HAHFGPAWSA-N |
| XLogP | 2.36 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |