C25H40N4O4 — CID 171711730
(3aS,4R,6aS)-5-[2-(dimethylamino)acetyl]-4-(2-methylphenyl)-N-pentyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxamide;acetic acid (PubChem CID 171711730) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3aS,4R,6aS)-5-[2-(dimethylamino)acetyl]-4-(2-methylphenyl)-N-pentyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxamide;acetic acid.
| Compound Name | (3aS,4R,6aS)-5-[2-(dimethylamino)acetyl]-4-(2-methylphenyl)-N-pentyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxamide;acetic acid |
|---|---|
| PubChem CID | 171711730 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (3aS,4R,6aS)-5-[2-(dimethylamino)acetyl]-4-(2-methylphenyl)-N-pentyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxamide;acetic acid |
| SMILES | CC(=O)O.CCCCCNC(=O)N1C[C@@H]2CN(C(=O)CN(C)C)[C@@H](c3ccccc3C)[C@@H]2C1 |
| InChI | InChI=1S/C23H36N4O2.C2H4O2/c1-5-6-9-12-24-23(29)26-13-18-14-27(21(28)16-25(3)4)22(20(18)15-26)19-11-8-7-10-17(19)2;1-2(3)4/h7-8,10-11,18,20,22H,5-6,9,12-16H2,1-4H3,(H,24,29);1H3,(H,3,4)/t18-,20-,22+;/m1./s1 |
| InChIKey | RFWCDGMOXKXQRQ-WTHRFEQYSA-N |
| XLogP | 2.98 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|