C20H28N4O — CID 171648474
4-(1,5-dimethylpyrazol-4-yl)-N-pentyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 171648474) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-N-pentyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-N-pentyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 171648474 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-N-pentyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CCCCCNC(=O)N1Cc2ccccc2C(c2cnn(C)c2C)C1 |
| InChI | InChI=1S/C20H28N4O/c1-4-5-8-11-21-20(25)24-13-16-9-6-7-10-17(16)19(14-24)18-12-22-23(3)15(18)2/h6-7,9-10,12,19H,4-5,8,11,13-14H2,1-3H3,(H,21,25) |
| InChIKey | BEEBVXJGPWCTKY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|