C20H27FN4O — CID 171648490
4-(1,5-dimethylpyrazol-4-yl)-N-(5-fluoropentyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 171648490) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-N-(5-fluoropentyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-N-(5-fluoropentyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 171648490 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-N-(5-fluoropentyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1c(C2CN(C(=O)NCCCCCF)Cc3ccccc32)cnn1C |
| InChI | InChI=1S/C20H27FN4O/c1-15-18(12-23-24(15)2)19-14-25(13-16-8-4-5-9-17(16)19)20(26)22-11-7-3-6-10-21/h4-5,8-9,12,19H,3,6-7,10-11,13-14H2,1-2H3,(H,22,26) |
| InChIKey | RXUFGLJPNVOUHI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|