C16H22N2O3 — CID 62230506
7-(1,3-dihydroisoindole-2-carbonylamino)heptanoic acid (PubChem CID 62230506) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoic acid.
| Compound Name | 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 62230506 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H22N2O3/c19-15(20)9-3-1-2-6-10-17-16(21)18-11-13-7-4-5-8-14(13)12-18/h4-5,7-8H,1-3,6,9-12H2,(H,17,21)(H,19,20) |
| InChIKey | SZEQZCVXOOMUEE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|