C23H32N2O3 — CID 143504622
cyclohexa-1,5-dien-1-ylmethyl 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoate;molecular hydrogen (PubChem CID 143504622) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoate;molecular hydrogen.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoate;molecular hydrogen |
|---|---|
| PubChem CID | 143504622 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl 7-(1,3-dihydroisoindole-2-carbonylamino)heptanoate;molecular hydrogen |
| SMILES | O=C(CCCCCCNC(=O)N1Cc2ccccc2C1)OCC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C23H30N2O3.H2/c26-22(28-18-19-10-4-3-5-11-19)14-6-1-2-9-15-24-23(27)25-16-20-12-7-8-13-21(20)17-25;/h4,7-8,10-13H,1-3,5-6,9,14-18H2,(H,24,27);1H |
| InChIKey | SVVOVPHONCEELG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|