C15H20N2O3 — CID 60591298
methyl 5-(2,3-dihydroindole-1-carbonylamino)pentanoate (PubChem CID 60591298) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 5-(2,3-dihydroindole-1-carbonylamino)pentanoate.
| Compound Name | methyl 5-(2,3-dihydroindole-1-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 60591298 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 5-(2,3-dihydroindole-1-carbonylamino)pentanoate |
| SMILES | COC(=O)CCCCNC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O3/c1-20-14(18)8-4-5-10-16-15(19)17-11-9-12-6-2-3-7-13(12)17/h2-3,6-7H,4-5,8-11H2,1H3,(H,16,19) |
| InChIKey | BMKDFEVLDPQLLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|