C19H22N2O — CID 108990483
N-(3-phenylpropyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 108990483) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 108990483 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(3-phenylpropyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H22N2O/c22-19(20-14-6-10-16-8-2-1-3-9-16)21-15-7-12-17-11-4-5-13-18(17)21/h1-5,8-9,11,13H,6-7,10,12,14-15H2,(H,20,22) |
| InChIKey | LWYIYEZHNXUNSI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|