C25H25N3O2 — CID 109089033
2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)pyridine-4-carboxamide (PubChem CID 109089033) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109089033 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccnc(C(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C25H25N3O2/c29-24(27-15-6-10-19-8-2-1-3-9-19)21-14-16-26-22(18-21)25(30)28-17-7-12-20-11-4-5-13-23(20)28/h1-5,8-9,11,13-14,16,18H,6-7,10,12,15,17H2,(H,27,29) |
| InChIKey | LZMQXPBORRWOEP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|