C26H26N2O2 — CID 109048489
4-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)benzamide (PubChem CID 109048489) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)benzamide.
| Compound Name | 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 109048489 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-phenylpropyl)benzamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(C(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O2/c29-25(27-18-6-10-20-8-2-1-3-9-20)22-14-16-23(17-15-22)26(30)28-19-7-12-21-11-4-5-13-24(21)28/h1-5,8-9,11,13-17H,6-7,10,12,18-19H2,(H,27,29) |
| InChIKey | PIMTZTRDYYMXMQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|