C17H23NO3 — CID 13101561
ethyl 6-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxohexanoate (PubChem CID 13101561) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 6-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxohexanoate.
| Compound Name | ethyl 6-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxohexanoate |
|---|---|
| PubChem CID | 13101561 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 6-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxohexanoate |
| SMILES | CCOC(=O)CCCCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H23NO3/c1-2-21-17(20)10-6-5-9-16(19)18-12-11-14-7-3-4-8-15(14)13-18/h3-4,7-8H,2,5-6,9-13H2,1H3 |
| InChIKey | BCTARRHYNZNQBD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|