C13H14N2O — CID 82113579
4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutanenitrile (PubChem CID 82113579) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutanenitrile.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutanenitrile |
|---|---|
| PubChem CID | 82113579 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutanenitrile |
| SMILES | N#CCCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H14N2O/c14-8-3-6-13(16)15-9-7-11-4-1-2-5-12(11)10-15/h1-2,4-5H,3,6-7,9-10H2 |
| InChIKey | UVTHJNKZVIXHDV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |